C12H16F3NO3 — CID 171226671
2-[(1S)-1-amino-4,4,4-trifluorobutyl]-3,5-dimethoxyphenol (PubChem CID 171226671) has the molecular formula C12H16F3NO3 and a molecular weight of 279.26 g/mol. Its IUPAC name is 2-[(1S)-1-amino-4,4,4-trifluorobutyl]-3,5-dimethoxyphenol.
| Compound Name | 2-[(1S)-1-amino-4,4,4-trifluorobutyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 171226671 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-[(1S)-1-amino-4,4,4-trifluorobutyl]-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c([C@@H](N)CCC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C12H16F3NO3/c1-18-7-5-9(17)11(10(6-7)19-2)8(16)3-4-12(13,14)15/h5-6,8,17H,3-4,16H2,1-2H3/t8-/m0/s1 |
| InChIKey | BCBQDUAJRSOCKV-QMMMGPOBSA-N |
| XLogP | 2.75 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|