C11H12F5NO3 — CID 171312435
2-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-3,5-dimethoxyphenol (PubChem CID 171312435) has the molecular formula C11H12F5NO3 and a molecular weight of 301.21 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-3,5-dimethoxyphenol.
| Compound Name | 2-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 171312435 |
| Molecular Formula | C11H12F5NO3 |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c([C@@H](N)C(F)(F)C(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C11H12F5NO3/c1-19-5-3-6(18)8(7(4-5)20-2)9(17)10(12,13)11(14,15)16/h3-4,9,18H,17H2,1-2H3/t9-/m1/s1 |
| InChIKey | HNAUYMAFEQHRIY-SECBINFHSA-N |
| XLogP | 2.61 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|