C13H21NO4 — CID 171248766
2-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3,5-dimethoxyphenol (PubChem CID 171248766) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3,5-dimethoxyphenol.
| Compound Name | 2-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 171248766 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c([C@H](N)C(C)(C)CO)c(OC)c1 |
| InChI | InChI=1S/C13H21NO4/c1-13(2,7-15)12(14)11-9(16)5-8(17-3)6-10(11)18-4/h5-6,12,15-16H,7,14H2,1-4H3/t12-/m0/s1 |
| InChIKey | CBWAWUNPLBKURP-LBPRGKRZSA-N |
| XLogP | 1.43 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|