C11H16O6 — CID 170819085
1-(2-hydroxy-4,6-dimethoxyphenyl)propane-1,2,3-triol (PubChem CID 170819085) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is 1-(2-hydroxy-4,6-dimethoxyphenyl)propane-1,2,3-triol.
| Compound Name | 1-(2-hydroxy-4,6-dimethoxyphenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170819085 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-(2-hydroxy-4,6-dimethoxyphenyl)propane-1,2,3-triol |
| SMILES | COc1cc(O)c(C(O)C(O)CO)c(OC)c1 |
| InChI | InChI=1S/C11H16O6/c1-16-6-3-7(13)10(9(4-6)17-2)11(15)8(14)5-12/h3-4,8,11-15H,5H2,1-2H3 |
| InChIKey | DLFXOCZYMIAAFZ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |