C17H21NO4 — CID 171263112
2-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]-3,5-dimethoxyphenol (PubChem CID 171263112) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]-3,5-dimethoxyphenol.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 171263112 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c([C@@H](N)[C@@H](O)Cc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C17H21NO4/c1-21-12-9-13(19)16(15(10-12)22-2)17(18)14(20)8-11-6-4-3-5-7-11/h3-7,9-10,14,17,19-20H,8,18H2,1-2H3/t14-,17-/m0/s1 |
| InChIKey | SPHXDLCMVHRYGG-YOEHRIQHSA-N |
| XLogP | 2.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|