C17H20O5 — CID 23628905
(2R,3S)-3-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylpropane-1,2-diol (PubChem CID 23628905) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is (2R,3S)-3-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylpropane-1,2-diol.
| Compound Name | (2R,3S)-3-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylpropane-1,2-diol |
|---|---|
| PubChem CID | 23628905 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (2R,3S)-3-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylpropane-1,2-diol |
| SMILES | COc1cc(O)c([C@H](c2ccccc2)[C@@H](O)CO)c(OC)c1 |
| InChI | InChI=1S/C17H20O5/c1-21-12-8-13(19)17(15(9-12)22-2)16(14(20)10-18)11-6-4-3-5-7-11/h3-9,14,16,18-20H,10H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | SCNIXYGAPUAKLU-GOEBONIOSA-N |
| XLogP | 1.89 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |