C11H16O5S — CID 170821135
1-(2-hydroxy-4,6-dimethoxyphenyl)-3-sulfanylpropane-1,2-diol (PubChem CID 170821135) has the molecular formula C11H16O5S and a molecular weight of 260.31 g/mol. Its IUPAC name is 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170821135 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-sulfanylpropane-1,2-diol |
| SMILES | COc1cc(O)c(C(O)C(O)CS)c(OC)c1 |
| InChI | InChI=1S/C11H16O5S/c1-15-6-3-7(12)10(9(4-6)16-2)11(14)8(13)5-17/h3-4,8,11-14,17H,5H2,1-2H3 |
| InChIKey | GJALBVMOFLMPPE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|