C10H14ClF2NO3 — CID 171242035
2-[(1R)-1-amino-2,2-difluoroethyl]-3,5-dimethoxyphenol;hydrochloride (PubChem CID 171242035) has the molecular formula C10H14ClF2NO3 and a molecular weight of 269.68 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-difluoroethyl]-3,5-dimethoxyphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-2,2-difluoroethyl]-3,5-dimethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171242035 |
| Molecular Formula | C10H14ClF2NO3 |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-difluoroethyl]-3,5-dimethoxyphenol;hydrochloride |
| SMILES | COc1cc(O)c([C@@H](N)C(F)F)c(OC)c1.Cl |
| InChI | InChI=1S/C10H13F2NO3.ClH/c1-15-5-3-6(14)8(7(4-5)16-2)9(13)10(11)12;/h3-4,9-10,14H,13H2,1-2H3;1H/t9-;/m1./s1 |
| InChIKey | OCMGTCIQVZNKHW-SBSPUUFOSA-N |
| XLogP | 2.10 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|