C13H20ClNO4 — CID 171263091
2-[(1R,2S)-1-amino-2-cyclopropyl-2-hydroxyethyl]-3,5-dimethoxyphenol;hydrochloride (PubChem CID 171263091) has the molecular formula C13H20ClNO4 and a molecular weight of 289.76 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-cyclopropyl-2-hydroxyethyl]-3,5-dimethoxyphenol;hydrochloride.
| Compound Name | 2-[(1R,2S)-1-amino-2-cyclopropyl-2-hydroxyethyl]-3,5-dimethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171263091 |
| Molecular Formula | C13H20ClNO4 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-cyclopropyl-2-hydroxyethyl]-3,5-dimethoxyphenol;hydrochloride |
| SMILES | COc1cc(O)c([C@@H](N)[C@@H](O)C2CC2)c(OC)c1.Cl |
| InChI | InChI=1S/C13H19NO4.ClH/c1-17-8-5-9(15)11(10(6-8)18-2)12(14)13(16)7-3-4-7;/h5-7,12-13,15-16H,3-4,14H2,1-2H3;1H/t12-,13+;/m1./s1 |
| InChIKey | QZLKZWXFJCRMSG-KZCZEQIWSA-N |
| XLogP | 1.60 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|