C14H23NO4 — CID 171268775
2-[(1S,2R)-1-amino-2-hydroxy-3,3-dimethylbutyl]-3,5-dimethoxyphenol (PubChem CID 171268775) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxy-3,3-dimethylbutyl]-3,5-dimethoxyphenol.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxy-3,3-dimethylbutyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 171268775 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxy-3,3-dimethylbutyl]-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c([C@H](N)[C@H](O)C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C14H23NO4/c1-14(2,3)13(17)12(15)11-9(16)6-8(18-4)7-10(11)19-5/h6-7,12-13,16-17H,15H2,1-5H3/t12-,13-/m0/s1 |
| InChIKey | VQCXAXSUFZJYOH-STQMWFEESA-N |
| XLogP | 1.82 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|