C10H13NO5 — CID 66513076
(2S)-2-amino-2-(2-hydroxy-4,6-dimethoxyphenyl)acetic acid (PubChem CID 66513076) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is (2S)-2-amino-2-(2-hydroxy-4,6-dimethoxyphenyl)acetic acid.
| Compound Name | (2S)-2-amino-2-(2-hydroxy-4,6-dimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 66513076 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | (2S)-2-amino-2-(2-hydroxy-4,6-dimethoxyphenyl)acetic acid |
| SMILES | COc1cc(O)c([C@H](N)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C10H13NO5/c1-15-5-3-6(12)8(7(4-5)16-2)9(11)10(13)14/h3-4,9,12H,11H2,1-2H3,(H,13,14)/t9-/m0/s1 |
| InChIKey | LCACFAKRPUZAHU-VIFPVBQESA-N |
| XLogP | 0.49 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|