C13H19ClFNO5 — CID 171242047
ethyl (3R)-3-amino-2-fluoro-3-(2-hydroxy-4,6-dimethoxyphenyl)propanoate;hydrochloride (PubChem CID 171242047) has the molecular formula C13H19ClFNO5 and a molecular weight of 323.75 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2-fluoro-3-(2-hydroxy-4,6-dimethoxyphenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3R)-3-amino-2-fluoro-3-(2-hydroxy-4,6-dimethoxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171242047 |
| Molecular Formula | C13H19ClFNO5 |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | ethyl (3R)-3-amino-2-fluoro-3-(2-hydroxy-4,6-dimethoxyphenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@H](N)c1c(O)cc(OC)cc1OC.Cl |
| InChI | InChI=1S/C13H18FNO5.ClH/c1-4-20-13(17)11(14)12(15)10-8(16)5-7(18-2)6-9(10)19-3;/h5-6,11-12,16H,4,15H2,1-3H3;1H/t11?,12-;/m1./s1 |
| InChIKey | COUFBLYJDAMEIW-ALGPSANZSA-N |
| XLogP | 1.73 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|