C14H19FO6 — CID 79369051
ethyl 2-fluoro-3-hydroxy-3-(2,4,6-trimethoxyphenyl)propanoate (PubChem CID 79369051) has the molecular formula C14H19FO6 and a molecular weight of 302.30 g/mol. Its IUPAC name is ethyl 2-fluoro-3-hydroxy-3-(2,4,6-trimethoxyphenyl)propanoate.
| Compound Name | ethyl 2-fluoro-3-hydroxy-3-(2,4,6-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 79369051 |
| Molecular Formula | C14H19FO6 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | ethyl 2-fluoro-3-hydroxy-3-(2,4,6-trimethoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(F)C(O)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C14H19FO6/c1-5-21-14(17)12(15)13(16)11-9(19-3)6-8(18-2)7-10(11)20-4/h6-7,12-13,16H,5H2,1-4H3 |
| InChIKey | GKBUAROZTVAOSK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |