C19H26O7 — CID 132570382
diethyl 2-[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enyl]propanedioate (PubChem CID 132570382) has the molecular formula C19H26O7 and a molecular weight of 366.41 g/mol. Its IUPAC name is diethyl 2-[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enyl]propanedioate.
| Compound Name | diethyl 2-[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 132570382 |
| Molecular Formula | C19H26O7 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | diethyl 2-[(E)-3-(2,4,6-trimethoxyphenyl)prop-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(C/C=C/c1c(OC)cc(OC)cc1OC)C(=O)OCC |
| InChI | InChI=1S/C19H26O7/c1-6-25-18(20)15(19(21)26-7-2)10-8-9-14-16(23-4)11-13(22-3)12-17(14)24-5/h8-9,11-12,15H,6-7,10H2,1-5H3/b9-8+ |
| InChIKey | MIRPAHQPXBWOHT-CMDGGOBGSA-N |
| XLogP | 2.86 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|