About ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate
ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate (PubChem CID 170796451) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate.
Molecular Properties
| Compound Name | ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate |
| PubChem CID | 170796451 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate |
| SMILES | CCOC(=O)CC=Cc1c(C)cc(OC)cc1C |
| InChI | InChI=1S/C15H20O3/c1-5-18-15(16)8-6-7-14-11(2)9-13(17-4)10-12(14)3/h6-7,9-10H,5,8H2,1-4H3 |
| InChIKey | MSWKHYVCWWRAAK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate?
The IUPAC name of ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate (CID 170796451) is ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate.
What is the SMILES notation for ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate?
The canonical SMILES for ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate is CCOC(=O)CC=Cc1c(C)cc(OC)cc1C.
What is the InChIKey of ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate?
The InChIKey is MSWKHYVCWWRAAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-5-18-15(16)8-6-7-14-11(2)9-13(17-4)10-12(14)3/h6-7,9-10H,5,8H2,1-4H3.
What are the key properties of ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate?
ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate has a molecular weight of 248.32 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(4-methoxy-2,6-dimethylphenyl)but-3-enoate is sourced from PubChem (CID 170796451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).