C15H23NO5 — CID 61498510
ethyl 2-[(2,4,6-trimethoxyphenyl)methylamino]propanoate (PubChem CID 61498510) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is ethyl 2-[(2,4,6-trimethoxyphenyl)methylamino]propanoate.
| Compound Name | ethyl 2-[(2,4,6-trimethoxyphenyl)methylamino]propanoate |
|---|---|
| PubChem CID | 61498510 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | ethyl 2-[(2,4,6-trimethoxyphenyl)methylamino]propanoate |
| SMILES | CCOC(=O)C(C)NCc1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C15H23NO5/c1-6-21-15(17)10(2)16-9-12-13(19-4)7-11(18-3)8-14(12)20-5/h7-8,10,16H,6,9H2,1-5H3 |
| InChIKey | IBJNAOLLZVMGON-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |