C13H20N2O4 — CID 103172348
ethyl 2-[(3,4-dimethoxy-2-pyridinyl)methylamino]propanoate (PubChem CID 103172348) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is ethyl 2-[(3,4-dimethoxy-2-pyridinyl)methylamino]propanoate.
| Compound Name | ethyl 2-[(3,4-dimethoxy-2-pyridinyl)methylamino]propanoate |
|---|---|
| PubChem CID | 103172348 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | ethyl 2-[(3,4-dimethoxy-2-pyridinyl)methylamino]propanoate |
| SMILES | CCOC(=O)C(C)NCc1nccc(OC)c1OC |
| InChI | InChI=1S/C13H20N2O4/c1-5-19-13(16)9(2)15-8-10-12(18-4)11(17-3)6-7-14-10/h6-7,9,15H,5,8H2,1-4H3 |
| InChIKey | QHAXMCZZXGGMLU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |