C16H26N2O2 — CID 103172633
(1S)-1-cyclohexyl-N-[(3,4-dimethoxy-2-pyridinyl)methyl]ethanamine (PubChem CID 103172633) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (1S)-1-cyclohexyl-N-[(3,4-dimethoxy-2-pyridinyl)methyl]ethanamine.
| Compound Name | (1S)-1-cyclohexyl-N-[(3,4-dimethoxy-2-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103172633 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (1S)-1-cyclohexyl-N-[(3,4-dimethoxy-2-pyridinyl)methyl]ethanamine |
| SMILES | COc1ccnc(CN[C@@H](C)C2CCCCC2)c1OC |
| InChI | InChI=1S/C16H26N2O2/c1-12(13-7-5-4-6-8-13)18-11-14-16(20-3)15(19-2)9-10-17-14/h9-10,12-13,18H,4-8,11H2,1-3H3/t12-/m0/s1 |
| InChIKey | NVSVCEJWIWWHKV-LBPRGKRZSA-N |
| XLogP | 3.16 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |