C15H24N2O — CID 81384352
(1R)-1-cyclohexyl-N-[(2-methoxy-3-pyridinyl)methyl]ethanamine (PubChem CID 81384352) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is (1R)-1-cyclohexyl-N-[(2-methoxy-3-pyridinyl)methyl]ethanamine.
| Compound Name | (1R)-1-cyclohexyl-N-[(2-methoxy-3-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 81384352 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (1R)-1-cyclohexyl-N-[(2-methoxy-3-pyridinyl)methyl]ethanamine |
| SMILES | COc1ncccc1CN[C@H](C)C1CCCCC1 |
| InChI | InChI=1S/C15H24N2O/c1-12(13-7-4-3-5-8-13)17-11-14-9-6-10-16-15(14)18-2/h6,9-10,12-13,17H,3-5,7-8,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | NSGYLWOFRPXPSE-GFCCVEGCSA-N |
| XLogP | 3.15 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |