C18H29NO2 — CID 81391569
(1S)-1-cycloheptyl-N-[(2,3-dimethoxyphenyl)methyl]ethanamine (PubChem CID 81391569) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is (1S)-1-cycloheptyl-N-[(2,3-dimethoxyphenyl)methyl]ethanamine.
| Compound Name | (1S)-1-cycloheptyl-N-[(2,3-dimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 81391569 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (1S)-1-cycloheptyl-N-[(2,3-dimethoxyphenyl)methyl]ethanamine |
| SMILES | COc1cccc(CN[C@@H](C)C2CCCCCC2)c1OC |
| InChI | InChI=1S/C18H29NO2/c1-14(15-9-6-4-5-7-10-15)19-13-16-11-8-12-17(20-2)18(16)21-3/h8,11-12,14-15,19H,4-7,9-10,13H2,1-3H3/t14-/m0/s1 |
| InChIKey | HCLGITHBNMLZPI-AWEZNQCLSA-N |
| XLogP | 4.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |