C14H21NO5 — CID 60787918
ethyl 2-(methylamino)-2-(2,4,6-trimethoxyphenyl)acetate (PubChem CID 60787918) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is ethyl 2-(methylamino)-2-(2,4,6-trimethoxyphenyl)acetate.
| Compound Name | ethyl 2-(methylamino)-2-(2,4,6-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 60787918 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | ethyl 2-(methylamino)-2-(2,4,6-trimethoxyphenyl)acetate |
| SMILES | CCOC(=O)C(NC)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C14H21NO5/c1-6-20-14(16)13(15-2)12-10(18-4)7-9(17-3)8-11(12)19-5/h7-8,13,15H,6H2,1-5H3 |
| InChIKey | ARCSENCVCAUNQA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |