C15H22N2O4 — CID 60995248
2-(cyclopropylmethylamino)-2-(2,4,6-trimethoxyphenyl)acetamide (PubChem CID 60995248) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-2-(2,4,6-trimethoxyphenyl)acetamide.
| Compound Name | 2-(cyclopropylmethylamino)-2-(2,4,6-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 60995248 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-(cyclopropylmethylamino)-2-(2,4,6-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(OC)c(C(NCC2CC2)C(N)=O)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O4/c1-19-10-6-11(20-2)13(12(7-10)21-3)14(15(16)18)17-8-9-4-5-9/h6-7,9,14,17H,4-5,8H2,1-3H3,(H2,16,18) |
| InChIKey | YHHONTBTHIYTJK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |