C17H26O7 — CID 174557224
diethyl 2-methylpropanedioate;1,3,5-trimethoxybenzene (PubChem CID 174557224) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is diethyl 2-methylpropanedioate;1,3,5-trimethoxybenzene.
| Compound Name | diethyl 2-methylpropanedioate;1,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 174557224 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | diethyl 2-methylpropanedioate;1,3,5-trimethoxybenzene |
| SMILES | CCOC(=O)C(C)C(=O)OCC.COc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C9H12O3.C8H14O4/c1-10-7-4-8(11-2)6-9(5-7)12-3;1-4-11-7(9)6(3)8(10)12-5-2/h4-6H,1-3H3;6H,4-5H2,1-3H3 |
| InChIKey | GGHKBBXKXGBSNC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|