C18H24O7 — CID 11739633
ethyl 2-(4-ethoxy-3-methyl-2,4-dioxobutyl)-4,6-dimethoxybenzoate (PubChem CID 11739633) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is ethyl 2-(4-ethoxy-3-methyl-2,4-dioxobutyl)-4,6-dimethoxybenzoate.
| Compound Name | ethyl 2-(4-ethoxy-3-methyl-2,4-dioxobutyl)-4,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 11739633 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | ethyl 2-(4-ethoxy-3-methyl-2,4-dioxobutyl)-4,6-dimethoxybenzoate |
| SMILES | CCOC(=O)c1c(CC(=O)C(C)C(=O)OCC)cc(OC)cc1OC |
| InChI | InChI=1S/C18H24O7/c1-6-24-17(20)11(3)14(19)9-12-8-13(22-4)10-15(23-5)16(12)18(21)25-7-2/h8,10-11H,6-7,9H2,1-5H3 |
| InChIKey | UITNLXDDYLOJFB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|