C13H19NO4 — CID 116915625
3-amino-1-(2,4,6-trimethoxyphenyl)butan-1-one (PubChem CID 116915625) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-amino-1-(2,4,6-trimethoxyphenyl)butan-1-one.
| Compound Name | 3-amino-1-(2,4,6-trimethoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 116915625 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 3-amino-1-(2,4,6-trimethoxyphenyl)butan-1-one |
| SMILES | COc1cc(OC)c(C(=O)CC(C)N)c(OC)c1 |
| InChI | InChI=1S/C13H19NO4/c1-8(14)5-10(15)13-11(17-3)6-9(16-2)7-12(13)18-4/h6-8H,5,14H2,1-4H3 |
| InChIKey | UZSFGQSAVWONLJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |