methyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate

C15H20O6 — CID 69082969

IUPACmethyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate
SMILESCOC(=O)CCCC(=O)c1c(OC)cc(OC)cc1OC
InChIInChI=1S/C15H20O6/c1-18-10-8-12(19-2)15(13(9-10)20-3)11(16)6-5-7-14(17)21-4/h8-9H,5-7H2,1-4H3
InChIKeyWGXOSLDTCWYDFN-UHFFFAOYSA-N
MW296.32 g/mol
LogP2.24
Rot. Bonds8

About methyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate

methyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate (PubChem CID 69082969) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is methyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate.

Molecular Properties

Compound Namemethyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate
PubChem CID69082969
Molecular FormulaC15H20O6
Molecular Weight296.32 g/mol
Exact Mass296.13
IUPAC Namemethyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate
SMILESCOC(=O)CCCC(=O)c1c(OC)cc(OC)cc1OC
InChIInChI=1S/C15H20O6/c1-18-10-8-12(19-2)15(13(9-10)20-3)11(16)6-5-7-14(17)21-4/h8-9H,5-7H2,1-4H3
InChIKeyWGXOSLDTCWYDFN-UHFFFAOYSA-N
XLogP2.24
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.32
LogP ≤ 52.24
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate?
The IUPAC name of methyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate (CID 69082969) is methyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate.
What is the SMILES notation for methyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate?
The canonical SMILES for methyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate is COC(=O)CCCC(=O)c1c(OC)cc(OC)cc1OC.
What is the InChIKey of methyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate?
The InChIKey is WGXOSLDTCWYDFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O6/c1-18-10-8-12(19-2)15(13(9-10)20-3)11(16)6-5-7-14(17)21-4/h8-9H,5-7H2,1-4H3.
What are the key properties of methyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate?
methyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate has a molecular weight of 296.32 g/mol, XLogP of 2.24, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoate is sourced from PubChem (CID 69082969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).