methyl 3-(2,4,6-trimethoxyphenyl)propanoate

C13H18O5 — CID 25107739

IUPACmethyl 3-(2,4,6-trimethoxyphenyl)propanoate
SMILESCOC(=O)CCc1c(OC)cc(OC)cc1OC
InChIInChI=1S/C13H18O5/c1-15-9-7-11(16-2)10(12(8-9)17-3)5-6-13(14)18-4/h7-8H,5-6H2,1-4H3
InChIKeyPLHQXUKOGKYEQE-UHFFFAOYSA-N
MW254.28 g/mol
LogP1.82
Rot. Bonds6

About methyl 3-(2,4,6-trimethoxyphenyl)propanoate

methyl 3-(2,4,6-trimethoxyphenyl)propanoate (PubChem CID 25107739) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is methyl 3-(2,4,6-trimethoxyphenyl)propanoate.

Molecular Properties

Compound Namemethyl 3-(2,4,6-trimethoxyphenyl)propanoate
PubChem CID25107739
Molecular FormulaC13H18O5
Molecular Weight254.28 g/mol
Exact Mass254.12
IUPAC Namemethyl 3-(2,4,6-trimethoxyphenyl)propanoate
SMILESCOC(=O)CCc1c(OC)cc(OC)cc1OC
InChIInChI=1S/C13H18O5/c1-15-9-7-11(16-2)10(12(8-9)17-3)5-6-13(14)18-4/h7-8H,5-6H2,1-4H3
InChIKeyPLHQXUKOGKYEQE-UHFFFAOYSA-N
XLogP1.82
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.28
LogP ≤ 51.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-(2,4,6-trimethoxyphenyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,4,6-trimethoxyphenyl)propanoate?
The IUPAC name of methyl 3-(2,4,6-trimethoxyphenyl)propanoate (CID 25107739) is methyl 3-(2,4,6-trimethoxyphenyl)propanoate.
What is the SMILES notation for methyl 3-(2,4,6-trimethoxyphenyl)propanoate?
The canonical SMILES for methyl 3-(2,4,6-trimethoxyphenyl)propanoate is COC(=O)CCc1c(OC)cc(OC)cc1OC.
What is the InChIKey of methyl 3-(2,4,6-trimethoxyphenyl)propanoate?
The InChIKey is PLHQXUKOGKYEQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O5/c1-15-9-7-11(16-2)10(12(8-9)17-3)5-6-13(14)18-4/h7-8H,5-6H2,1-4H3.
What are the key properties of methyl 3-(2,4,6-trimethoxyphenyl)propanoate?
methyl 3-(2,4,6-trimethoxyphenyl)propanoate has a molecular weight of 254.28 g/mol, XLogP of 1.82, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,4,6-trimethoxyphenyl)propanoate is sourced from PubChem (CID 25107739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).