methyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate

C14H20O3 — CID 98784006

IUPACmethyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate
SMILESCOC(=O)CCCc1c(C)cc(C)cc1OC
InChIInChI=1S/C14H20O3/c1-10-8-11(2)12(13(9-10)16-3)6-5-7-14(15)17-4/h8-9H,5-7H2,1-4H3
InChIKeyZQHPMGGKCURCNK-UHFFFAOYSA-N
MW236.31 g/mol
LogP2.81
Rot. Bonds5

About methyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate

methyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate (PubChem CID 98784006) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is methyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate.

Molecular Properties

Compound Namemethyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate
PubChem CID98784006
Molecular FormulaC14H20O3
Molecular Weight236.31 g/mol
Exact Mass236.14
IUPAC Namemethyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate
SMILESCOC(=O)CCCc1c(C)cc(C)cc1OC
InChIInChI=1S/C14H20O3/c1-10-8-11(2)12(13(9-10)16-3)6-5-7-14(15)17-4/h8-9H,5-7H2,1-4H3
InChIKeyZQHPMGGKCURCNK-UHFFFAOYSA-N
XLogP2.81
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.31
LogP ≤ 52.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate?
The IUPAC name of methyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate (CID 98784006) is methyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate.
What is the SMILES notation for methyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate?
The canonical SMILES for methyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate is COC(=O)CCCc1c(C)cc(C)cc1OC.
What is the InChIKey of methyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate?
The InChIKey is ZQHPMGGKCURCNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-10-8-11(2)12(13(9-10)16-3)6-5-7-14(15)17-4/h8-9H,5-7H2,1-4H3.
What are the key properties of methyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate?
methyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate has a molecular weight of 236.31 g/mol, XLogP of 2.81, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2-methoxy-4,6-dimethylphenyl)butanoate is sourced from PubChem (CID 98784006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).