C15H25NO — CID 98783993
3-(2-methoxy-4,6-dimethylphenyl)-N-propan-2-ylpropan-1-amine (PubChem CID 98783993) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 3-(2-methoxy-4,6-dimethylphenyl)-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-(2-methoxy-4,6-dimethylphenyl)-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 98783993 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 3-(2-methoxy-4,6-dimethylphenyl)-N-propan-2-ylpropan-1-amine |
| SMILES | COc1cc(C)cc(C)c1CCCNC(C)C |
| InChI | InChI=1S/C15H25NO/c1-11(2)16-8-6-7-14-13(4)9-12(3)10-15(14)17-5/h9-11,16H,6-8H2,1-5H3 |
| InChIKey | NBGJRIXQAQQNST-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|