4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid

C15H23NO3 — CID 115218737

IUPAC4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid
SMILESCOc1cc(C)cc(C)c1CCNCCCC(=O)O
InChIInChI=1S/C15H23NO3/c1-11-9-12(2)13(14(10-11)19-3)6-8-16-7-4-5-15(17)18/h9-10,16H,4-8H2,1-3H3,(H,17,18)
InChIKeyXVFOGTNLDWLOTP-UHFFFAOYSA-N
MW265.35 g/mol
LogP2.31
Rot. Bonds8

About 4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid

4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid (PubChem CID 115218737) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid.

Molecular Properties

Compound Name4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid
PubChem CID115218737
Molecular FormulaC15H23NO3
Molecular Weight265.35 g/mol
Exact Mass265.17
IUPAC Name4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid
SMILESCOc1cc(C)cc(C)c1CCNCCCC(=O)O
InChIInChI=1S/C15H23NO3/c1-11-9-12(2)13(14(10-11)19-3)6-8-16-7-4-5-15(17)18/h9-10,16H,4-8H2,1-3H3,(H,17,18)
InChIKeyXVFOGTNLDWLOTP-UHFFFAOYSA-N
XLogP2.31
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.35
LogP ≤ 52.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid?
The IUPAC name of 4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid (CID 115218737) is 4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid.
What is the SMILES notation for 4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid?
The canonical SMILES for 4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid is COc1cc(C)cc(C)c1CCNCCCC(=O)O.
What is the InChIKey of 4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid?
The InChIKey is XVFOGTNLDWLOTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c1-11-9-12(2)13(14(10-11)19-3)6-8-16-7-4-5-15(17)18/h9-10,16H,4-8H2,1-3H3,(H,17,18).
What are the key properties of 4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid?
4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid has a molecular weight of 265.35 g/mol, XLogP of 2.31, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]butanoic acid is sourced from PubChem (CID 115218737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).