2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid

C12H17NO3 — CID 115171165

IUPAC2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid
SMILESCOc1cc(C)cc(C)c1CCNC(=O)O
InChIInChI=1S/C12H17NO3/c1-8-6-9(2)10(11(7-8)16-3)4-5-13-12(14)15/h6-7,13H,4-5H2,1-3H3,(H,14,15)
InChIKeyKJNXFUGYVNJSKB-UHFFFAOYSA-N
MW223.27 g/mol
LogP2.12
Rot. Bonds4

About 2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid

2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid (PubChem CID 115171165) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid.

Molecular Properties

Compound Name2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid
PubChem CID115171165
Molecular FormulaC12H17NO3
Molecular Weight223.27 g/mol
Exact Mass223.12
IUPAC Name2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid
SMILESCOc1cc(C)cc(C)c1CCNC(=O)O
InChIInChI=1S/C12H17NO3/c1-8-6-9(2)10(11(7-8)16-3)4-5-13-12(14)15/h6-7,13H,4-5H2,1-3H3,(H,14,15)
InChIKeyKJNXFUGYVNJSKB-UHFFFAOYSA-N
XLogP2.12
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.27
LogP ≤ 52.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid?
The IUPAC name of 2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid (CID 115171165) is 2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid.
What is the SMILES notation for 2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid?
The canonical SMILES for 2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid is COc1cc(C)cc(C)c1CCNC(=O)O.
What is the InChIKey of 2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid?
The InChIKey is KJNXFUGYVNJSKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-8-6-9(2)10(11(7-8)16-3)4-5-13-12(14)15/h6-7,13H,4-5H2,1-3H3,(H,14,15).
What are the key properties of 2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid?
2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid has a molecular weight of 223.27 g/mol, XLogP of 2.12, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxy-4,6-dimethylphenyl)ethylcarbamic acid is sourced from PubChem (CID 115171165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).