C15H25ClN2O4 — CID 119320840
4-amino-N-[2-(2,4,6-trimethoxyphenyl)ethyl]butanamide;hydrochloride (PubChem CID 119320840) has the molecular formula C15H25ClN2O4 and a molecular weight of 332.83 g/mol. Its IUPAC name is 4-amino-N-[2-(2,4,6-trimethoxyphenyl)ethyl]butanamide;hydrochloride.
| Compound Name | 4-amino-N-[2-(2,4,6-trimethoxyphenyl)ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119320840 |
| Molecular Formula | C15H25ClN2O4 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 4-amino-N-[2-(2,4,6-trimethoxyphenyl)ethyl]butanamide;hydrochloride |
| SMILES | COc1cc(OC)c(CCNC(=O)CCCN)c(OC)c1.Cl |
| InChI | InChI=1S/C15H24N2O4.ClH/c1-19-11-9-13(20-2)12(14(10-11)21-3)6-8-17-15(18)5-4-7-16;/h9-10H,4-8,16H2,1-3H3,(H,17,18);1H |
| InChIKey | ZEYXFKAPNXTUSI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |