methyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate

C12H16O5 — CID 12862928

IUPACmethyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate
SMILESCOC(=O)CCc1cc(OC)c(OC)cc1O
InChIInChI=1S/C12H16O5/c1-15-10-6-8(4-5-12(14)17-3)9(13)7-11(10)16-2/h6-7,13H,4-5H2,1-3H3
InChIKeyVZAVESOFFKUXBA-UHFFFAOYSA-N
MW240.25 g/mol
LogP1.51
Rot. Bonds5

About methyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate

methyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate (PubChem CID 12862928) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is methyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate.

Molecular Properties

Compound Namemethyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate
PubChem CID12862928
Molecular FormulaC12H16O5
Molecular Weight240.25 g/mol
Exact Mass240.10
IUPAC Namemethyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate
SMILESCOC(=O)CCc1cc(OC)c(OC)cc1O
InChIInChI=1S/C12H16O5/c1-15-10-6-8(4-5-12(14)17-3)9(13)7-11(10)16-2/h6-7,13H,4-5H2,1-3H3
InChIKeyVZAVESOFFKUXBA-UHFFFAOYSA-N
XLogP1.51
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.25
LogP ≤ 51.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate?
The IUPAC name of methyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate (CID 12862928) is methyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate.
What is the SMILES notation for methyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate?
The canonical SMILES for methyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate is COC(=O)CCc1cc(OC)c(OC)cc1O.
What is the InChIKey of methyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate?
The InChIKey is VZAVESOFFKUXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O5/c1-15-10-6-8(4-5-12(14)17-3)9(13)7-11(10)16-2/h6-7,13H,4-5H2,1-3H3.
What are the key properties of methyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate?
methyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate has a molecular weight of 240.25 g/mol, XLogP of 1.51, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate is sourced from PubChem (CID 12862928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).