C14H20O5 — CID 123255123
butyl 3-(2,4-dihydroxy-5-methoxyphenyl)propanoate (PubChem CID 123255123) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is butyl 3-(2,4-dihydroxy-5-methoxyphenyl)propanoate.
| Compound Name | butyl 3-(2,4-dihydroxy-5-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 123255123 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | butyl 3-(2,4-dihydroxy-5-methoxyphenyl)propanoate |
| SMILES | CCCCOC(=O)CCc1cc(OC)c(O)cc1O |
| InChI | InChI=1S/C14H20O5/c1-3-4-7-19-14(17)6-5-10-8-13(18-2)12(16)9-11(10)15/h8-9,15-16H,3-7H2,1-2H3 |
| InChIKey | YLXXHCQRIGITRQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|