C13H18O5 — CID 135071124
butyl 2-(3,4-dihydroxy-5-methoxyphenyl)acetate (PubChem CID 135071124) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is butyl 2-(3,4-dihydroxy-5-methoxyphenyl)acetate.
| Compound Name | butyl 2-(3,4-dihydroxy-5-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 135071124 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | butyl 2-(3,4-dihydroxy-5-methoxyphenyl)acetate |
| SMILES | CCCCOC(=O)Cc1cc(O)c(O)c(OC)c1 |
| InChI | InChI=1S/C13H18O5/c1-3-4-5-18-12(15)8-9-6-10(14)13(16)11(7-9)17-2/h6-7,14,16H,3-5,8H2,1-2H3 |
| InChIKey | LMQUWNFSSDCOIO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|