C18H17I3O4 — CID 121230787
butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate (PubChem CID 121230787) has the molecular formula C18H17I3O4 and a molecular weight of 678.04 g/mol. Its IUPAC name is butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate.
| Compound Name | butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate |
|---|---|
| PubChem CID | 121230787 |
| Molecular Formula | C18H17I3O4 |
| Molecular Weight | 678.04 g/mol |
| Exact Mass | 677.83 |
| IUPAC Name | butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate |
| SMILES | CCCCOC(=O)Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1 |
| InChI | InChI=1S/C18H17I3O4/c1-2-3-6-24-17(23)9-11-7-14(20)18(15(21)8-11)25-12-4-5-16(22)13(19)10-12/h4-5,7-8,10,22H,2-3,6,9H2,1H3 |
| InChIKey | YMRWXBGVGDQQHQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.04 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|