About butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate
butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate (PubChem CID 121230787) has the molecular formula C18H17I3O4
and a molecular weight of 678.04 g/mol. Its IUPAC name is butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate.
Molecular Properties
| Compound Name | butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate |
| PubChem CID | 121230787 |
| Molecular Formula | C18H17I3O4 |
| Molecular Weight | 678.04 g/mol |
| Exact Mass | 677.83 |
| IUPAC Name | butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate |
| SMILES | CCCCOC(=O)Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1 |
| InChI | InChI=1S/C18H17I3O4/c1-2-3-6-24-17(23)9-11-7-14(20)18(15(21)8-11)25-12-4-5-16(22)13(19)10-12/h4-5,7-8,10,22H,2-3,6,9H2,1H3 |
| InChIKey | YMRWXBGVGDQQHQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 678.04 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate?
The IUPAC name of butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate (CID 121230787) is butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate.
What is the SMILES notation for butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate?
The canonical SMILES for butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate is CCCCOC(=O)Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1.
What is the InChIKey of butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate?
The InChIKey is YMRWXBGVGDQQHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17I3O4/c1-2-3-6-24-17(23)9-11-7-14(20)18(15(21)8-11)25-12-4-5-16(22)13(19)10-12/h4-5,7-8,10,22H,2-3,6,9H2,1H3.
What are the key properties of butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate?
butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate has a molecular weight of 678.04 g/mol, XLogP of 5.88, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetate is sourced from PubChem (CID 121230787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).