C15H15F3I3NO4 — CID 158399844
4-[4-[(Z)-3-amino-2-hydroperoxyprop-2-enyl]-2,6-diiodophenoxy]-2-iodophenol;trihydrofluoride (PubChem CID 158399844) has the molecular formula C15H15F3I3NO4 and a molecular weight of 710.99 g/mol. Its IUPAC name is 4-[4-[(Z)-3-amino-2-hydroperoxyprop-2-enyl]-2,6-diiodophenoxy]-2-iodophenol;trihydrofluoride.
| Compound Name | 4-[4-[(Z)-3-amino-2-hydroperoxyprop-2-enyl]-2,6-diiodophenoxy]-2-iodophenol;trihydrofluoride |
|---|---|
| PubChem CID | 158399844 |
| Molecular Formula | C15H15F3I3NO4 |
| Molecular Weight | 710.99 g/mol |
| Exact Mass | 710.81 |
| IUPAC Name | 4-[4-[(Z)-3-amino-2-hydroperoxyprop-2-enyl]-2,6-diiodophenoxy]-2-iodophenol;trihydrofluoride |
| SMILES | F.F.F.N/C=C(/Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)OO |
| InChI | InChI=1S/C15H12I3NO4.3FH/c16-11-6-9(1-2-14(11)20)22-15-12(17)4-8(5-13(15)18)3-10(7-19)23-21;;;/h1-2,4-7,20-21H,3,19H2;3*1H/b10-7-;;; |
| InChIKey | GXYWTEOQKRJMPV-SULXSYCDSA-N |
| XLogP | 5.29 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.99 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|