C22H34N2O3 — CID 14547333
butyl 2-[4-hydroxy-3,5-bis(pyrrolidin-1-ylmethyl)phenyl]acetate (PubChem CID 14547333) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is butyl 2-[4-hydroxy-3,5-bis(pyrrolidin-1-ylmethyl)phenyl]acetate.
| Compound Name | butyl 2-[4-hydroxy-3,5-bis(pyrrolidin-1-ylmethyl)phenyl]acetate |
|---|---|
| PubChem CID | 14547333 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | butyl 2-[4-hydroxy-3,5-bis(pyrrolidin-1-ylmethyl)phenyl]acetate |
| SMILES | CCCCOC(=O)Cc1cc(CN2CCCC2)c(O)c(CN2CCCC2)c1 |
| InChI | InChI=1S/C22H34N2O3/c1-2-3-12-27-21(25)15-18-13-19(16-23-8-4-5-9-23)22(26)20(14-18)17-24-10-6-7-11-24/h13-14,26H,2-12,15-17H2,1H3 |
| InChIKey | VACNCQAVMQELEA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|