C22H37NO — CID 21092695
2,6-bis(2,2-dimethylpropyl)-4-(piperidin-1-ylmethyl)phenol (PubChem CID 21092695) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is 2,6-bis(2,2-dimethylpropyl)-4-(piperidin-1-ylmethyl)phenol.
| Compound Name | 2,6-bis(2,2-dimethylpropyl)-4-(piperidin-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 21092695 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | 2,6-bis(2,2-dimethylpropyl)-4-(piperidin-1-ylmethyl)phenol |
| SMILES | CC(C)(C)Cc1cc(CN2CCCCC2)cc(CC(C)(C)C)c1O |
| InChI | InChI=1S/C22H37NO/c1-21(2,3)14-18-12-17(16-23-10-8-7-9-11-23)13-19(20(18)24)15-22(4,5)6/h12-13,24H,7-11,14-16H2,1-6H3 |
| InChIKey | JLJDLZZZORIMFZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |