C15H23N — CID 170618261
1-[(3,4-diethylphenyl)methyl]pyrrolidine (PubChem CID 170618261) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 1-[(3,4-diethylphenyl)methyl]pyrrolidine.
| Compound Name | 1-[(3,4-diethylphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 170618261 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1-[(3,4-diethylphenyl)methyl]pyrrolidine |
| SMILES | CCc1ccc(CN2CCCC2)cc1CC |
| InChI | InChI=1S/C15H23N/c1-3-14-8-7-13(11-15(14)4-2)12-16-9-5-6-10-16/h7-8,11H,3-6,9-10,12H2,1-2H3 |
| InChIKey | YDEFGMFYCGJBAK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |