C16H27N — CID 176955142
1-[(3,4-dimethylphenyl)methyl]piperidine;ethane (PubChem CID 176955142) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 1-[(3,4-dimethylphenyl)methyl]piperidine;ethane.
| Compound Name | 1-[(3,4-dimethylphenyl)methyl]piperidine;ethane |
|---|---|
| PubChem CID | 176955142 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 1-[(3,4-dimethylphenyl)methyl]piperidine;ethane |
| SMILES | CC.Cc1ccc(CN2CCCCC2)cc1C |
| InChI | InChI=1S/C14H21N.C2H6/c1-12-6-7-14(10-13(12)2)11-15-8-4-3-5-9-15;1-2/h6-7,10H,3-5,8-9,11H2,1-2H3;1-2H3 |
| InChIKey | YBHVTRKERSMAEF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |