C14H22N2 — CID 71214328
1-[(3,4-dimethylphenyl)methyl]-4-methylpiperazine (PubChem CID 71214328) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-[(3,4-dimethylphenyl)methyl]-4-methylpiperazine.
| Compound Name | 1-[(3,4-dimethylphenyl)methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 71214328 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-[(3,4-dimethylphenyl)methyl]-4-methylpiperazine |
| SMILES | Cc1ccc(CN2CCN(C)CC2)cc1C |
| InChI | InChI=1S/C14H22N2/c1-12-4-5-14(10-13(12)2)11-16-8-6-15(3)7-9-16/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | ZVEYJLMIVQCGKR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |