C19H32N2 — CID 173324718
N-[2-(3,4-dimethylphenyl)ethyl]-4-piperidin-1-ylbutan-1-amine (PubChem CID 173324718) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is N-[2-(3,4-dimethylphenyl)ethyl]-4-piperidin-1-ylbutan-1-amine.
| Compound Name | N-[2-(3,4-dimethylphenyl)ethyl]-4-piperidin-1-ylbutan-1-amine |
|---|---|
| PubChem CID | 173324718 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | N-[2-(3,4-dimethylphenyl)ethyl]-4-piperidin-1-ylbutan-1-amine |
| SMILES | Cc1ccc(CCNCCCCN2CCCCC2)cc1C |
| InChI | InChI=1S/C19H32N2/c1-17-8-9-19(16-18(17)2)10-12-20-11-4-7-15-21-13-5-3-6-14-21/h8-9,16,20H,3-7,10-15H2,1-2H3 |
| InChIKey | NJRXBMJCVWKQDK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|