C13H19FN2 — CID 122519320
1-[(4-ethyl-3-fluorophenyl)methyl]piperazine (PubChem CID 122519320) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-[(4-ethyl-3-fluorophenyl)methyl]piperazine.
| Compound Name | 1-[(4-ethyl-3-fluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 122519320 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 1-[(4-ethyl-3-fluorophenyl)methyl]piperazine |
| SMILES | CCc1ccc(CN2CCNCC2)cc1F |
| InChI | InChI=1S/C13H19FN2/c1-2-12-4-3-11(9-13(12)14)10-16-7-5-15-6-8-16/h3-4,9,15H,2,5-8,10H2,1H3 |
| InChIKey | KHPFYKWMSVGBQC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |