C12H14F4N2O — CID 138985666
1-[[3-fluoro-4-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 138985666) has the molecular formula C12H14F4N2O and a molecular weight of 278.25 g/mol. Its IUPAC name is 1-[[3-fluoro-4-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[[3-fluoro-4-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 138985666 |
| Molecular Formula | C12H14F4N2O |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 1-[[3-fluoro-4-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | Fc1cc(CN2CCNCC2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C12H14F4N2O/c13-10-7-9(8-18-5-3-17-4-6-18)1-2-11(10)19-12(14,15)16/h1-2,7,17H,3-6,8H2 |
| InChIKey | RBEXCNYUZXAZHQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |