C11H11ClF3NO — CID 151114566
1-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]azetidine (PubChem CID 151114566) has the molecular formula C11H11ClF3NO and a molecular weight of 265.66 g/mol. Its IUPAC name is 1-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]azetidine.
| Compound Name | 1-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]azetidine |
|---|---|
| PubChem CID | 151114566 |
| Molecular Formula | C11H11ClF3NO |
| Molecular Weight | 265.66 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 1-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]azetidine |
| SMILES | FC(F)(F)Oc1ccc(CN2CCC2)cc1Cl |
| InChI | InChI=1S/C11H11ClF3NO/c12-9-6-8(7-16-4-1-5-16)2-3-10(9)17-11(13,14)15/h2-3,6H,1,4-5,7H2 |
| InChIKey | MQWMCHDGXSBRKZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.66 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |