C20H26F3N3O3 — CID 154218742
2-[[5-(pyrrolidin-1-ylmethyl)-2-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid (PubChem CID 154218742) has the molecular formula C20H26F3N3O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is 2-[[5-(pyrrolidin-1-ylmethyl)-2-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid.
| Compound Name | 2-[[5-(pyrrolidin-1-ylmethyl)-2-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 154218742 |
| Molecular Formula | C20H26F3N3O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 2-[[5-(pyrrolidin-1-ylmethyl)-2-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
| SMILES | O=C(O)N1CC2CN(Cc3cc(CN4CCCC4)ccc3OC(F)(F)F)CC2C1 |
| InChI | InChI=1S/C20H26F3N3O3/c21-20(22,23)29-18-4-3-14(8-24-5-1-2-6-24)7-15(18)9-25-10-16-12-26(19(27)28)13-17(16)11-25/h3-4,7,16-17H,1-2,5-6,8-13H2,(H,27,28) |
| InChIKey | JINIAMMZZDFMFI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |