C21H29N3O3 — CID 154235560
2-[[2-methyl-3-(piperidine-1-carbonyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid (PubChem CID 154235560) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-[[2-methyl-3-(piperidine-1-carbonyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid.
| Compound Name | 2-[[2-methyl-3-(piperidine-1-carbonyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 154235560 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2-[[2-methyl-3-(piperidine-1-carbonyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
| SMILES | Cc1c(CN2CC3CN(C(=O)O)CC3C2)cccc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H29N3O3/c1-15-16(6-5-7-19(15)20(25)23-8-3-2-4-9-23)10-22-11-17-13-24(21(26)27)14-18(17)12-22/h5-7,17-18H,2-4,8-14H2,1H3,(H,26,27) |
| InChIKey | PYXJEBSHZLGZPK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |