C21H24F9N3O4 — CID 122530048
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-(morpholin-4-ylmethyl)-2-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 122530048) has the molecular formula C21H24F9N3O4 and a molecular weight of 553.42 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-(morpholin-4-ylmethyl)-2-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-(morpholin-4-ylmethyl)-2-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122530048 |
| Molecular Formula | C21H24F9N3O4 |
| Molecular Weight | 553.42 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-(morpholin-4-ylmethyl)-2-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(Cc2ccc(CN3CCOCC3)cc2OC(F)(F)F)CC1 |
| InChI | InChI=1S/C21H24F9N3O4/c22-19(23,24)17(20(25,26)27)36-18(34)33-5-3-31(4-6-33)13-15-2-1-14(11-16(15)37-21(28,29)30)12-32-7-9-35-10-8-32/h1-2,11,17H,3-10,12-13H2 |
| InChIKey | NJHSQOCWWGRJJE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |