C19H22F6N2O5 — CID 152812921
(2S)-2-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylphenoxy]propanoic acid (PubChem CID 152812921) has the molecular formula C19H22F6N2O5 and a molecular weight of 472.38 g/mol. Its IUPAC name is (2S)-2-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylphenoxy]propanoic acid.
| Compound Name | (2S)-2-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylphenoxy]propanoic acid |
|---|---|
| PubChem CID | 152812921 |
| Molecular Formula | C19H22F6N2O5 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (2S)-2-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-methylphenoxy]propanoic acid |
| SMILES | Cc1ccc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c(O[C@@H](C)C(=O)O)c1 |
| InChI | InChI=1S/C19H22F6N2O5/c1-11-3-4-13(14(9-11)31-12(2)15(28)29)10-26-5-7-27(8-6-26)17(30)32-16(18(20,21)22)19(23,24)25/h3-4,9,12,16H,5-8,10H2,1-2H3,(H,28,29)/t12-/m0/s1 |
| InChIKey | SRSBLOSACHXYGJ-LBPRGKRZSA-N |
| XLogP | 3.59 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |